C31H29N3O6S — CID 70576587
2-[4-[(1,3-dioxoisoindol-2-yl)-phenylmethoxy]carbonyl-8-phenyl-1-thia-3,8-diazaspiro[4.5]decan-2-yl]acetic acid (PubChem CID 70576587) has the molecular formula C31H29N3O6S and a molecular weight of 571.66 g/mol. Its IUPAC name is 2-[4-[(1,3-dioxoisoindol-2-yl)-phenylmethoxy]carbonyl-8-phenyl-1-thia-3,8-diazaspiro[4.5]decan-2-yl]acetic acid.
| Compound Name | 2-[4-[(1,3-dioxoisoindol-2-yl)-phenylmethoxy]carbonyl-8-phenyl-1-thia-3,8-diazaspiro[4.5]decan-2-yl]acetic acid |
|---|---|
| PubChem CID | 70576587 |
| Molecular Formula | C31H29N3O6S |
| Molecular Weight | 571.66 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 2-[4-[(1,3-dioxoisoindol-2-yl)-phenylmethoxy]carbonyl-8-phenyl-1-thia-3,8-diazaspiro[4.5]decan-2-yl]acetic acid |
| SMILES | O=C(O)CC1NC(C(=O)OC(c2ccccc2)N2C(=O)c3ccccc3C2=O)C2(CCN(c3ccccc3)CC2)S1 |
| InChI | InChI=1S/C31H29N3O6S/c35-25(36)19-24-32-26(31(41-24)15-17-33(18-16-31)21-11-5-2-6-12-21)30(39)40-29(20-9-3-1-4-10-20)34-27(37)22-13-7-8-14-23(22)28(34)38/h1-14,24,26,29,32H,15-19H2,(H,35,36) |
| InChIKey | OWJGZMOOHFZSKJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.66 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|