C34H48N2O4 — CID 70576669
bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-(2-benzylphenyl)propanedioate (PubChem CID 70576669) has the molecular formula C34H48N2O4 and a molecular weight of 548.77 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-(2-benzylphenyl)propanedioate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-(2-benzylphenyl)propanedioate |
|---|---|
| PubChem CID | 70576669 |
| Molecular Formula | C34H48N2O4 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.36 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2-(2-benzylphenyl)propanedioate |
| SMILES | CC1(C)CC(OC(=O)C(C(=O)OC2CC(C)(C)NC(C)(C)C2)c2ccccc2Cc2ccccc2)CC(C)(C)N1 |
| InChI | InChI=1S/C34H48N2O4/c1-31(2)19-25(20-32(3,4)35-31)39-29(37)28(30(38)40-26-21-33(5,6)36-34(7,8)22-26)27-17-13-12-16-24(27)18-23-14-10-9-11-15-23/h9-17,25-26,28,35-36H,18-22H2,1-8H3 |
| InChIKey | IYIJGYNFFSHSMI-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|