C14H26N2O — CID 70576794
4-butyl-2,2,5,7,7-pentamethyl-1H-1,4-diazepin-3-one (PubChem CID 70576794) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is 4-butyl-2,2,5,7,7-pentamethyl-1H-1,4-diazepin-3-one.
| Compound Name | 4-butyl-2,2,5,7,7-pentamethyl-1H-1,4-diazepin-3-one |
|---|---|
| PubChem CID | 70576794 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 4-butyl-2,2,5,7,7-pentamethyl-1H-1,4-diazepin-3-one |
| SMILES | CCCCN1C(=O)C(C)(C)NC(C)(C)C=C1C |
| InChI | InChI=1S/C14H26N2O/c1-7-8-9-16-11(2)10-13(3,4)15-14(5,6)12(16)17/h10,15H,7-9H2,1-6H3 |
| InChIKey | MPIDCLUTYWQINY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |