About 2-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]ethanol
2-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]ethanol (PubChem CID 70576919) has the molecular formula C14H26O3
and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]ethanol.
Molecular Properties
| Compound Name | 2-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]ethanol |
| PubChem CID | 70576919 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 2-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]ethanol |
| SMILES | CCCCCCC=C[C@@H]1OCOC[C@H]1CCO |
| InChI | InChI=1S/C14H26O3/c1-2-3-4-5-6-7-8-14-13(9-10-15)11-16-12-17-14/h7-8,13-15H,2-6,9-12H2,1H3/t13-,14+/m1/s1 |
| InChIKey | SSUKDQCFODTAIE-KGLIPLIRSA-N |
| XLogP | 2.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]ethanol?
The IUPAC name of 2-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]ethanol (CID 70576919) is 2-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]ethanol.
What is the SMILES notation for 2-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]ethanol?
The canonical SMILES for 2-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]ethanol is CCCCCCC=C[C@@H]1OCOC[C@H]1CCO.
What is the InChIKey of 2-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]ethanol?
The InChIKey is SSUKDQCFODTAIE-KGLIPLIRSA-N. The full InChI is InChI=1S/C14H26O3/c1-2-3-4-5-6-7-8-14-13(9-10-15)11-16-12-17-14/h7-8,13-15H,2-6,9-12H2,1H3/t13-,14+/m1/s1.
What are the key properties of 2-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]ethanol?
2-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]ethanol has a molecular weight of 242.36 g/mol, XLogP of 2.88, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]ethanol is sourced from PubChem (CID 70576919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).