About 1-N-ethyl-2-methyl-1-N-propylbenzene-1,4-diamine;methanesulfonamide
1-N-ethyl-2-methyl-1-N-propylbenzene-1,4-diamine;methanesulfonamide (PubChem CID 70576933) has the molecular formula C13H25N3O2S
and a molecular weight of 287.43 g/mol. Its IUPAC name is 1-N-ethyl-2-methyl-1-N-propylbenzene-1,4-diamine;methanesulfonamide.
Molecular Properties
| Compound Name | 1-N-ethyl-2-methyl-1-N-propylbenzene-1,4-diamine;methanesulfonamide |
| PubChem CID | 70576933 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 1-N-ethyl-2-methyl-1-N-propylbenzene-1,4-diamine;methanesulfonamide |
| SMILES | CCCN(CC)c1ccc(N)cc1C.CS(N)(=O)=O |
| InChI | InChI=1S/C12H20N2.CH5NO2S/c1-4-8-14(5-2)12-7-6-11(13)9-10(12)3;1-5(2,3)4/h6-7,9H,4-5,8,13H2,1-3H3;1H3,(H2,2,3,4) |
| InChIKey | VNXDYKPTXIIWCW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-N-ethyl-2-methyl-1-N-propylbenzene-1,4-diamine;methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-ethyl-2-methyl-1-N-propylbenzene-1,4-diamine;methanesulfonamide?
The IUPAC name of 1-N-ethyl-2-methyl-1-N-propylbenzene-1,4-diamine;methanesulfonamide (CID 70576933) is 1-N-ethyl-2-methyl-1-N-propylbenzene-1,4-diamine;methanesulfonamide.
What is the SMILES notation for 1-N-ethyl-2-methyl-1-N-propylbenzene-1,4-diamine;methanesulfonamide?
The canonical SMILES for 1-N-ethyl-2-methyl-1-N-propylbenzene-1,4-diamine;methanesulfonamide is CCCN(CC)c1ccc(N)cc1C.CS(N)(=O)=O.
What is the InChIKey of 1-N-ethyl-2-methyl-1-N-propylbenzene-1,4-diamine;methanesulfonamide?
The InChIKey is VNXDYKPTXIIWCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2.CH5NO2S/c1-4-8-14(5-2)12-7-6-11(13)9-10(12)3;1-5(2,3)4/h6-7,9H,4-5,8,13H2,1-3H3;1H3,(H2,2,3,4).
What are the key properties of 1-N-ethyl-2-methyl-1-N-propylbenzene-1,4-diamine;methanesulfonamide?
1-N-ethyl-2-methyl-1-N-propylbenzene-1,4-diamine;methanesulfonamide has a molecular weight of 287.43 g/mol, XLogP of 1.72, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-ethyl-2-methyl-1-N-propylbenzene-1,4-diamine;methanesulfonamide is sourced from PubChem (CID 70576933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).