About 1H-imidazole;3-methoxypropanoic acid
1H-imidazole;3-methoxypropanoic acid (PubChem CID 70577075) has the molecular formula C7H12N2O3
and a molecular weight of 172.18 g/mol. Its IUPAC name is 1H-imidazole;3-methoxypropanoic acid.
Molecular Properties
| Compound Name | 1H-imidazole;3-methoxypropanoic acid |
| PubChem CID | 70577075 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 1H-imidazole;3-methoxypropanoic acid |
| SMILES | COCCC(=O)O.c1c[nH]cn1 |
| InChI | InChI=1S/C4H8O3.C3H4N2/c1-7-3-2-4(5)6;1-2-5-3-4-1/h2-3H2,1H3,(H,5,6);1-3H,(H,4,5) |
| InChIKey | MZXYUPNYNFBEJR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-imidazole;3-methoxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;3-methoxypropanoic acid?
The IUPAC name of 1H-imidazole;3-methoxypropanoic acid (CID 70577075) is 1H-imidazole;3-methoxypropanoic acid.
What is the SMILES notation for 1H-imidazole;3-methoxypropanoic acid?
The canonical SMILES for 1H-imidazole;3-methoxypropanoic acid is COCCC(=O)O.c1c[nH]cn1.
What is the InChIKey of 1H-imidazole;3-methoxypropanoic acid?
The InChIKey is MZXYUPNYNFBEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3.C3H4N2/c1-7-3-2-4(5)6;1-2-5-3-4-1/h2-3H2,1H3,(H,5,6);1-3H,(H,4,5).
What are the key properties of 1H-imidazole;3-methoxypropanoic acid?
1H-imidazole;3-methoxypropanoic acid has a molecular weight of 172.18 g/mol, XLogP of 0.52, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;3-methoxypropanoic acid is sourced from PubChem (CID 70577075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).