C18H28O4S — CID 70577575
4-methyl-5-(4-octan-2-ylsulfonylphenyl)-1,3-dioxolane (PubChem CID 70577575) has the molecular formula C18H28O4S and a molecular weight of 340.49 g/mol. Its IUPAC name is 4-methyl-5-(4-octan-2-ylsulfonylphenyl)-1,3-dioxolane.
| Compound Name | 4-methyl-5-(4-octan-2-ylsulfonylphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 70577575 |
| Molecular Formula | C18H28O4S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 4-methyl-5-(4-octan-2-ylsulfonylphenyl)-1,3-dioxolane |
| SMILES | CCCCCCC(C)S(=O)(=O)c1ccc(C2OCOC2C)cc1 |
| InChI | InChI=1S/C18H28O4S/c1-4-5-6-7-8-14(2)23(19,20)17-11-9-16(10-12-17)18-15(3)21-13-22-18/h9-12,14-15,18H,4-8,13H2,1-3H3 |
| InChIKey | YEVLQQMCERUULG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|