About 2-chloro-2-phenyl-3,4-dihydrothiochromene
2-chloro-2-phenyl-3,4-dihydrothiochromene (PubChem CID 70578232) has the molecular formula C15H13ClS
and a molecular weight of 260.79 g/mol. Its IUPAC name is 2-chloro-2-phenyl-3,4-dihydrothiochromene.
Molecular Properties
| Compound Name | 2-chloro-2-phenyl-3,4-dihydrothiochromene |
| PubChem CID | 70578232 |
| Molecular Formula | C15H13ClS |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-chloro-2-phenyl-3,4-dihydrothiochromene |
| SMILES | ClC1(c2ccccc2)CCc2ccccc2S1 |
| InChI | InChI=1S/C15H13ClS/c16-15(13-7-2-1-3-8-13)11-10-12-6-4-5-9-14(12)17-15/h1-9H,10-11H2 |
| InChIKey | VIYXSENDIWOLIW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-2-phenyl-3,4-dihydrothiochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-2-phenyl-3,4-dihydrothiochromene?
The IUPAC name of 2-chloro-2-phenyl-3,4-dihydrothiochromene (CID 70578232) is 2-chloro-2-phenyl-3,4-dihydrothiochromene.
What is the SMILES notation for 2-chloro-2-phenyl-3,4-dihydrothiochromene?
The canonical SMILES for 2-chloro-2-phenyl-3,4-dihydrothiochromene is ClC1(c2ccccc2)CCc2ccccc2S1.
What is the InChIKey of 2-chloro-2-phenyl-3,4-dihydrothiochromene?
The InChIKey is VIYXSENDIWOLIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClS/c16-15(13-7-2-1-3-8-13)11-10-12-6-4-5-9-14(12)17-15/h1-9H,10-11H2.
What are the key properties of 2-chloro-2-phenyl-3,4-dihydrothiochromene?
2-chloro-2-phenyl-3,4-dihydrothiochromene has a molecular weight of 260.79 g/mol, XLogP of 4.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-2-phenyl-3,4-dihydrothiochromene is sourced from PubChem (CID 70578232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).