C10H16N4O3S — CID 70578236
1-nitro-2-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]but-1-ene-2,3-diamine (PubChem CID 70578236) has the molecular formula C10H16N4O3S and a molecular weight of 272.33 g/mol. Its IUPAC name is 1-nitro-2-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]but-1-ene-2,3-diamine.
| Compound Name | 1-nitro-2-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]but-1-ene-2,3-diamine |
|---|---|
| PubChem CID | 70578236 |
| Molecular Formula | C10H16N4O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 1-nitro-2-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]but-1-ene-2,3-diamine |
| SMILES | CC(N)C(=C[N+](=O)[O-])NCCSCc1ccon1 |
| InChI | InChI=1S/C10H16N4O3S/c1-8(11)10(6-14(15)16)12-3-5-18-7-9-2-4-17-13-9/h2,4,6,8,12H,3,5,7,11H2,1H3 |
| InChIKey | WHTZVNLFLVAAOC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|