About [1,4-bis(2-methylpropyl)cyclohexa-2,4-dien-1-yl]methyl-trimethylazanium chloride
[1,4-bis(2-methylpropyl)cyclohexa-2,4-dien-1-yl]methyl-trimethylazanium chloride (PubChem CID 70578239) has the molecular formula C18H34ClN
and a molecular weight of 299.93 g/mol. Its IUPAC name is [1,4-bis(2-methylpropyl)cyclohexa-2,4-dien-1-yl]methyl-trimethylazanium chloride.
Molecular Properties
| Compound Name | [1,4-bis(2-methylpropyl)cyclohexa-2,4-dien-1-yl]methyl-trimethylazanium chloride |
| PubChem CID | 70578239 |
| Molecular Formula | C18H34ClN |
| Molecular Weight | 299.93 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | [1,4-bis(2-methylpropyl)cyclohexa-2,4-dien-1-yl]methyl-trimethylazanium chloride |
| SMILES | CC(C)CC1=CCC(CC(C)C)(C[N+](C)(C)C)C=C1.[Cl-] |
| InChI | InChI=1S/C18H34N.ClH/c1-15(2)12-17-8-10-18(11-9-17,13-16(3)4)14-19(5,6)7;/h8-10,15-16H,11-14H2,1-7H3;1H/q+1;/p-1 |
| InChIKey | HXNHHAFUZWBZMB-UHFFFAOYSA-M |
| XLogP | 1.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.93 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [1,4-bis(2-methylpropyl)cyclohexa-2,4-dien-1-yl]methyl-trimethylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,4-bis(2-methylpropyl)cyclohexa-2,4-dien-1-yl]methyl-trimethylazanium chloride?
The IUPAC name of [1,4-bis(2-methylpropyl)cyclohexa-2,4-dien-1-yl]methyl-trimethylazanium chloride (CID 70578239) is [1,4-bis(2-methylpropyl)cyclohexa-2,4-dien-1-yl]methyl-trimethylazanium chloride.
What is the SMILES notation for [1,4-bis(2-methylpropyl)cyclohexa-2,4-dien-1-yl]methyl-trimethylazanium chloride?
The canonical SMILES for [1,4-bis(2-methylpropyl)cyclohexa-2,4-dien-1-yl]methyl-trimethylazanium chloride is CC(C)CC1=CCC(CC(C)C)(C[N+](C)(C)C)C=C1.[Cl-].
What is the InChIKey of [1,4-bis(2-methylpropyl)cyclohexa-2,4-dien-1-yl]methyl-trimethylazanium chloride?
The InChIKey is HXNHHAFUZWBZMB-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H34N.ClH/c1-15(2)12-17-8-10-18(11-9-17,13-16(3)4)14-19(5,6)7;/h8-10,15-16H,11-14H2,1-7H3;1H/q+1;/p-1.
What are the key properties of [1,4-bis(2-methylpropyl)cyclohexa-2,4-dien-1-yl]methyl-trimethylazanium chloride?
[1,4-bis(2-methylpropyl)cyclohexa-2,4-dien-1-yl]methyl-trimethylazanium chloride has a molecular weight of 299.93 g/mol, XLogP of 1.66, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [1,4-bis(2-methylpropyl)cyclohexa-2,4-dien-1-yl]methyl-trimethylazanium chloride is sourced from PubChem (CID 70578239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).