C11H9Cl4NO6 — CID 70578444
1-[(4S)-5-chloro-5-methyl-2,3,6-trioxo-1-azabicyclo[2.1.1]hexan-4-yl]ethyl 2,2,2-trichloroethyl carbonate (PubChem CID 70578444) has the molecular formula C11H9Cl4NO6 and a molecular weight of 393.01 g/mol. Its IUPAC name is 1-[(4S)-5-chloro-5-methyl-2,3,6-trioxo-1-azabicyclo[2.1.1]hexan-4-yl]ethyl 2,2,2-trichloroethyl carbonate.
| Compound Name | 1-[(4S)-5-chloro-5-methyl-2,3,6-trioxo-1-azabicyclo[2.1.1]hexan-4-yl]ethyl 2,2,2-trichloroethyl carbonate |
|---|---|
| PubChem CID | 70578444 |
| Molecular Formula | C11H9Cl4NO6 |
| Molecular Weight | 393.01 g/mol |
| Exact Mass | 390.92 |
| IUPAC Name | 1-[(4S)-5-chloro-5-methyl-2,3,6-trioxo-1-azabicyclo[2.1.1]hexan-4-yl]ethyl 2,2,2-trichloroethyl carbonate |
| SMILES | CC(OC(=O)OCC(Cl)(Cl)Cl)[C@]12C(=O)C(=O)N(C1=O)C2(C)Cl |
| InChI | InChI=1S/C11H9Cl4NO6/c1-4(22-8(20)21-3-10(13,14)15)11-5(17)6(18)16(7(11)19)9(11,2)12/h4H,3H2,1-2H3/t4?,9?,11-/m0/s1 |
| InChIKey | NKARYTQHEMSTTI-YBVYRURTSA-N |
| XLogP | 1.79 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.01 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|