C11H12N2 — CID 70578501
2,3,3a,4-tetrahydro-1H-pyrrolo[3,4-c]quinoline (PubChem CID 70578501) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1H-pyrrolo[3,4-c]quinoline.
| Compound Name | 2,3,3a,4-tetrahydro-1H-pyrrolo[3,4-c]quinoline |
|---|---|
| PubChem CID | 70578501 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1H-pyrrolo[3,4-c]quinoline |
| SMILES | c1ccc2c(c1)=NCC1CNCC=21 |
| InChI | InChI=1S/C11H12N2/c1-2-4-11-9(3-1)10-7-12-5-8(10)6-13-11/h1-4,8,12H,5-7H2 |
| InChIKey | KYVRNNQVKZLJHV-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |