About N,N-bis(prop-2-enyl)-3,4-dihydropyridin-2-amine
N,N-bis(prop-2-enyl)-3,4-dihydropyridin-2-amine (PubChem CID 70579189) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)-3,4-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | N,N-bis(prop-2-enyl)-3,4-dihydropyridin-2-amine |
| PubChem CID | 70579189 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N,N-bis(prop-2-enyl)-3,4-dihydropyridin-2-amine |
| SMILES | C=CCN(CC=C)C1=NC=CCC1 |
| InChI | InChI=1S/C11H16N2/c1-3-9-13(10-4-2)11-7-5-6-8-12-11/h3-4,6,8H,1-2,5,7,9-10H2 |
| InChIKey | FZDRGPKCQYQMMD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis(prop-2-enyl)-3,4-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(prop-2-enyl)-3,4-dihydropyridin-2-amine?
The IUPAC name of N,N-bis(prop-2-enyl)-3,4-dihydropyridin-2-amine (CID 70579189) is N,N-bis(prop-2-enyl)-3,4-dihydropyridin-2-amine.
What is the SMILES notation for N,N-bis(prop-2-enyl)-3,4-dihydropyridin-2-amine?
The canonical SMILES for N,N-bis(prop-2-enyl)-3,4-dihydropyridin-2-amine is C=CCN(CC=C)C1=NC=CCC1.
What is the InChIKey of N,N-bis(prop-2-enyl)-3,4-dihydropyridin-2-amine?
The InChIKey is FZDRGPKCQYQMMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-3-9-13(10-4-2)11-7-5-6-8-12-11/h3-4,6,8H,1-2,5,7,9-10H2.
What are the key properties of N,N-bis(prop-2-enyl)-3,4-dihydropyridin-2-amine?
N,N-bis(prop-2-enyl)-3,4-dihydropyridin-2-amine has a molecular weight of 176.26 g/mol, XLogP of 2.37, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(prop-2-enyl)-3,4-dihydropyridin-2-amine is sourced from PubChem (CID 70579189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).