About 3-sulfanylpropanoate
3-sulfanylpropanoate (PubChem CID 7057961) has the molecular formula C3H5O2S-
and a molecular weight of 105.14 g/mol. Its IUPAC name is 3-sulfanylpropanoate.
Molecular Properties
| Compound Name | 3-sulfanylpropanoate |
| PubChem CID | 7057961 |
| Molecular Formula | C3H5O2S- |
| Molecular Weight | 105.14 g/mol |
| Exact Mass | 105.00 |
| IUPAC Name | 3-sulfanylpropanoate |
| SMILES | O=C([O-])CCS |
| InChI | InChI=1S/C3H6O2S/c4-3(5)1-2-6/h6H,1-2H2,(H,4,5)/p-1 |
| InChIKey | DKIDEFUBRARXTE-UHFFFAOYSA-M |
| XLogP | -0.94 |
| TPSA | 40.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.14 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfanylpropanoate?
The IUPAC name of 3-sulfanylpropanoate (CID 7057961) is 3-sulfanylpropanoate.
What is the SMILES notation for 3-sulfanylpropanoate?
The canonical SMILES for 3-sulfanylpropanoate is O=C([O-])CCS.
What is the InChIKey of 3-sulfanylpropanoate?
The InChIKey is DKIDEFUBRARXTE-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O2S/c4-3(5)1-2-6/h6H,1-2H2,(H,4,5)/p-1.
What are the key properties of 3-sulfanylpropanoate?
3-sulfanylpropanoate has a molecular weight of 105.14 g/mol, XLogP of -0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfanylpropanoate is sourced from PubChem (CID 7057961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).