About benzhydrylbenzene;2H-oxazine
benzhydrylbenzene;2H-oxazine (PubChem CID 70579894) has the molecular formula C23H21NO
and a molecular weight of 327.43 g/mol. Its IUPAC name is benzhydrylbenzene;2H-oxazine.
Molecular Properties
| Compound Name | benzhydrylbenzene;2H-oxazine |
| PubChem CID | 70579894 |
| Molecular Formula | C23H21NO |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | benzhydrylbenzene;2H-oxazine |
| SMILES | C1=CNOC=C1.c1ccc(C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16.C4H5NO/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-4-6-5-3-1/h1-15,19H;1-5H |
| InChIKey | SUTLHAAXIRMIOS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze benzhydrylbenzene;2H-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydrylbenzene;2H-oxazine?
The IUPAC name of benzhydrylbenzene;2H-oxazine (CID 70579894) is benzhydrylbenzene;2H-oxazine.
What is the SMILES notation for benzhydrylbenzene;2H-oxazine?
The canonical SMILES for benzhydrylbenzene;2H-oxazine is C1=CNOC=C1.c1ccc(C(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzhydrylbenzene;2H-oxazine?
The InChIKey is SUTLHAAXIRMIOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16.C4H5NO/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-4-6-5-3-1/h1-15,19H;1-5H.
What are the key properties of benzhydrylbenzene;2H-oxazine?
benzhydrylbenzene;2H-oxazine has a molecular weight of 327.43 g/mol, XLogP of 5.42, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydrylbenzene;2H-oxazine is sourced from PubChem (CID 70579894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).