About naphthalene-2-thiol
naphthalene-2-thiol (PubChem CID 7058) has the molecular formula C10H8S
and a molecular weight of 160.24 g/mol. Its IUPAC name is naphthalene-2-thiol.
Molecular Properties
| Compound Name | naphthalene-2-thiol |
| PubChem CID | 7058 |
| Molecular Formula | C10H8S |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | naphthalene-2-thiol |
| SMILES | Sc1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8S/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H |
| InChIKey | RFCQDOVPMUSZMN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-2-thiol?
The IUPAC name of naphthalene-2-thiol (CID 7058) is naphthalene-2-thiol.
What is the SMILES notation for naphthalene-2-thiol?
The canonical SMILES for naphthalene-2-thiol is Sc1ccc2ccccc2c1.
What is the InChIKey of naphthalene-2-thiol?
The InChIKey is RFCQDOVPMUSZMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8S/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H.
What are the key properties of naphthalene-2-thiol?
naphthalene-2-thiol has a molecular weight of 160.24 g/mol, XLogP of 3.13, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-2-thiol is sourced from PubChem (CID 7058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).