C9H20NO+ — CID 7058007
2,2,6,6-tetramethylpiperidin-1-ium-4-ol (PubChem CID 7058007) has the molecular formula C9H20NO+ and a molecular weight of 158.26 g/mol. Its IUPAC name is 2,2,6,6-tetramethylpiperidin-1-ium-4-ol.
| Compound Name | 2,2,6,6-tetramethylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7058007 |
| Molecular Formula | C9H20NO+ |
| Molecular Weight | 158.26 g/mol |
| Exact Mass | 158.15 |
| IUPAC Name | 2,2,6,6-tetramethylpiperidin-1-ium-4-ol |
| SMILES | CC1(C)CC(O)CC(C)(C)[NH2+]1 |
| InChI | InChI=1S/C9H19NO/c1-8(2)5-7(11)6-9(3,4)10-8/h7,10-11H,5-6H2,1-4H3/p+1 |
| InChIKey | VDVUCLWJZJHFAV-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |