C34H74OSi3 — CID 70580123
2,2,3,3,4,4,6,6-octabutyloxatrisilinane (PubChem CID 70580123) has the molecular formula C34H74OSi3 and a molecular weight of 583.22 g/mol. Its IUPAC name is 2,2,3,3,4,4,6,6-octabutyloxatrisilinane.
| Compound Name | 2,2,3,3,4,4,6,6-octabutyloxatrisilinane |
|---|---|
| PubChem CID | 70580123 |
| Molecular Formula | C34H74OSi3 |
| Molecular Weight | 583.22 g/mol |
| Exact Mass | 582.50 |
| IUPAC Name | 2,2,3,3,4,4,6,6-octabutyloxatrisilinane |
| SMILES | CCCCC1(CCCC)C[Si](CCCC)(CCCC)[Si](CCCC)(CCCC)[Si](CCCC)(CCCC)O1 |
| InChI | InChI=1S/C34H74OSi3/c1-9-17-25-34(26-18-10-2)33-36(27-19-11-3,28-20-12-4)38(31-23-15-7,32-24-16-8)37(35-34,29-21-13-5)30-22-14-6/h9-33H2,1-8H3 |
| InChIKey | RBEKWWPWBVNPST-UHFFFAOYSA-N |
| XLogP | 12.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.22 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|