About 4-propyl-3H-pyridine-2,4-diamine
4-propyl-3H-pyridine-2,4-diamine (PubChem CID 70580143) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is 4-propyl-3H-pyridine-2,4-diamine.
Molecular Properties
| Compound Name | 4-propyl-3H-pyridine-2,4-diamine |
| PubChem CID | 70580143 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 4-propyl-3H-pyridine-2,4-diamine |
| SMILES | CCCC1(N)C=CN=C(N)C1 |
| InChI | InChI=1S/C8H15N3/c1-2-3-8(10)4-5-11-7(9)6-8/h4-5H,2-3,6,10H2,1H3,(H2,9,11) |
| InChIKey | ZFRWLBOKFXEXDV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-propyl-3H-pyridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propyl-3H-pyridine-2,4-diamine?
The IUPAC name of 4-propyl-3H-pyridine-2,4-diamine (CID 70580143) is 4-propyl-3H-pyridine-2,4-diamine.
What is the SMILES notation for 4-propyl-3H-pyridine-2,4-diamine?
The canonical SMILES for 4-propyl-3H-pyridine-2,4-diamine is CCCC1(N)C=CN=C(N)C1.
What is the InChIKey of 4-propyl-3H-pyridine-2,4-diamine?
The InChIKey is ZFRWLBOKFXEXDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3/c1-2-3-8(10)4-5-11-7(9)6-8/h4-5H,2-3,6,10H2,1H3,(H2,9,11).
What are the key properties of 4-propyl-3H-pyridine-2,4-diamine?
4-propyl-3H-pyridine-2,4-diamine has a molecular weight of 153.23 g/mol, XLogP of 0.76, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propyl-3H-pyridine-2,4-diamine is sourced from PubChem (CID 70580143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).