About 2-ethyl-6-methoxy-3,6-dihydro-2H-pyran-3-ol
2-ethyl-6-methoxy-3,6-dihydro-2H-pyran-3-ol (PubChem CID 70580186) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-ethyl-6-methoxy-3,6-dihydro-2H-pyran-3-ol.
Molecular Properties
| Compound Name | 2-ethyl-6-methoxy-3,6-dihydro-2H-pyran-3-ol |
| PubChem CID | 70580186 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 2-ethyl-6-methoxy-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CCC1OC(OC)C=CC1O |
| InChI | InChI=1S/C8H14O3/c1-3-7-6(9)4-5-8(10-2)11-7/h4-9H,3H2,1-2H3 |
| InChIKey | MSFOMJQMCNGIEB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-6-methoxy-3,6-dihydro-2H-pyran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6-methoxy-3,6-dihydro-2H-pyran-3-ol?
The IUPAC name of 2-ethyl-6-methoxy-3,6-dihydro-2H-pyran-3-ol (CID 70580186) is 2-ethyl-6-methoxy-3,6-dihydro-2H-pyran-3-ol.
What is the SMILES notation for 2-ethyl-6-methoxy-3,6-dihydro-2H-pyran-3-ol?
The canonical SMILES for 2-ethyl-6-methoxy-3,6-dihydro-2H-pyran-3-ol is CCC1OC(OC)C=CC1O.
What is the InChIKey of 2-ethyl-6-methoxy-3,6-dihydro-2H-pyran-3-ol?
The InChIKey is MSFOMJQMCNGIEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-3-7-6(9)4-5-8(10-2)11-7/h4-9H,3H2,1-2H3.
What are the key properties of 2-ethyl-6-methoxy-3,6-dihydro-2H-pyran-3-ol?
2-ethyl-6-methoxy-3,6-dihydro-2H-pyran-3-ol has a molecular weight of 158.20 g/mol, XLogP of 0.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-methoxy-3,6-dihydro-2H-pyran-3-ol is sourced from PubChem (CID 70580186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).