C10H12O — CID 7058028
(1R)-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 7058028) has the molecular formula C10H12O and a molecular weight of 148.21 g/mol. Its IUPAC name is (1R)-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | (1R)-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 7058028 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | (1R)-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | O[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C10H12O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10-11H,3,5,7H2/t10-/m1/s1 |
| InChIKey | JAAJQSRLGAYGKZ-SNVBAGLBSA-N |
| XLogP | 2.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |