C22H26N2O3S2 — CID 70580415
2-[2-[2-(2-aminophenyl)sulfanylethoxy]ethylsulfanyl]aniline;benzene-1,4-diol (PubChem CID 70580415) has the molecular formula C22H26N2O3S2 and a molecular weight of 430.59 g/mol. Its IUPAC name is 2-[2-[2-(2-aminophenyl)sulfanylethoxy]ethylsulfanyl]aniline;benzene-1,4-diol.
| Compound Name | 2-[2-[2-(2-aminophenyl)sulfanylethoxy]ethylsulfanyl]aniline;benzene-1,4-diol |
|---|---|
| PubChem CID | 70580415 |
| Molecular Formula | C22H26N2O3S2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2-[2-[2-(2-aminophenyl)sulfanylethoxy]ethylsulfanyl]aniline;benzene-1,4-diol |
| SMILES | Nc1ccccc1SCCOCCSc1ccccc1N.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C16H20N2OS2.C6H6O2/c17-13-5-1-3-7-15(13)20-11-9-19-10-12-21-16-8-4-2-6-14(16)18;7-5-1-2-6(8)4-3-5/h1-8H,9-12,17-18H2;1-4,7-8H |
| InChIKey | BHOLAKVESNCWFQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|