C11H22N2 — CID 70580608
2-pentyl-2,3,4,7-tetrahydroazepin-1-amine (PubChem CID 70580608) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-pentyl-2,3,4,7-tetrahydroazepin-1-amine.
| Compound Name | 2-pentyl-2,3,4,7-tetrahydroazepin-1-amine |
|---|---|
| PubChem CID | 70580608 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 2-pentyl-2,3,4,7-tetrahydroazepin-1-amine |
| SMILES | CCCCCC1CCC=CCN1N |
| InChI | InChI=1S/C11H22N2/c1-2-3-5-8-11-9-6-4-7-10-13(11)12/h4,7,11H,2-3,5-6,8-10,12H2,1H3 |
| InChIKey | PFYJKUUQWWPPKU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|