About (3S,5S)-3,5-dimethylpiperidin-1-ium
(3S,5S)-3,5-dimethylpiperidin-1-ium (PubChem CID 7058086) has the molecular formula C7H16N+
and a molecular weight of 114.21 g/mol. Its IUPAC name is (3S,5S)-3,5-dimethylpiperidin-1-ium.
Molecular Properties
| Compound Name | (3S,5S)-3,5-dimethylpiperidin-1-ium |
| PubChem CID | 7058086 |
| Molecular Formula | C7H16N+ |
| Molecular Weight | 114.21 g/mol |
| Exact Mass | 114.13 |
| IUPAC Name | (3S,5S)-3,5-dimethylpiperidin-1-ium |
| SMILES | C[C@@H]1C[NH2+]C[C@@H](C)C1 |
| InChI | InChI=1S/C7H15N/c1-6-3-7(2)5-8-4-6/h6-8H,3-5H2,1-2H3/p+1/t6-,7-/m0/s1 |
| InChIKey | IDWRJRPUIXRFRX-BQBZGAKWSA-O |
| XLogP | 0.23 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.21 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (3S,5S)-3,5-dimethylpiperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-3,5-dimethylpiperidin-1-ium?
The IUPAC name of (3S,5S)-3,5-dimethylpiperidin-1-ium (CID 7058086) is (3S,5S)-3,5-dimethylpiperidin-1-ium.
What is the SMILES notation for (3S,5S)-3,5-dimethylpiperidin-1-ium?
The canonical SMILES for (3S,5S)-3,5-dimethylpiperidin-1-ium is C[C@@H]1C[NH2+]C[C@@H](C)C1.
What is the InChIKey of (3S,5S)-3,5-dimethylpiperidin-1-ium?
The InChIKey is IDWRJRPUIXRFRX-BQBZGAKWSA-O. The full InChI is InChI=1S/C7H15N/c1-6-3-7(2)5-8-4-6/h6-8H,3-5H2,1-2H3/p+1/t6-,7-/m0/s1.
What are the key properties of (3S,5S)-3,5-dimethylpiperidin-1-ium?
(3S,5S)-3,5-dimethylpiperidin-1-ium has a molecular weight of 114.21 g/mol, XLogP of 0.23, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-3,5-dimethylpiperidin-1-ium is sourced from PubChem (CID 7058086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).