C29H46O4 — CID 70581352
(5R)-5-[(5S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3,6-dioxo-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoic acid;ethene (PubChem CID 70581352) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is (5R)-5-[(5S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3,6-dioxo-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoic acid;ethene.
| Compound Name | (5R)-5-[(5S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3,6-dioxo-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoic acid;ethene |
|---|---|
| PubChem CID | 70581352 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | (5R)-5-[(5S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3,6-dioxo-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoic acid;ethene |
| SMILES | C=C.C=C.C[C@H](CCCC(=O)O)[C@H]1CC[C@H]2[C@@H]3CC(=O)[C@H]4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H38O4.2C2H4/c1-15(5-4-6-23(28)29)18-7-8-19-17-14-22(27)21-13-16(26)9-11-25(21,3)20(17)10-12-24(18,19)2;2*1-2/h15,17-21H,4-14H2,1-3H3,(H,28,29);2*1-2H2/t15-,17+,18-,19+,20+,21-,24-,25-;;/m1../s1 |
| InChIKey | KSBYEMFXGVZMOM-TZZVJNOLSA-N |
| XLogP | 6.89 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|