About 5-chloro-5-methylcyclohexa-1,3-dien-1-amine;hydrochloride
5-chloro-5-methylcyclohexa-1,3-dien-1-amine;hydrochloride (PubChem CID 70581444) has the molecular formula C7H11Cl2N
and a molecular weight of 180.08 g/mol. Its IUPAC name is 5-chloro-5-methylcyclohexa-1,3-dien-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-chloro-5-methylcyclohexa-1,3-dien-1-amine;hydrochloride |
| PubChem CID | 70581444 |
| Molecular Formula | C7H11Cl2N |
| Molecular Weight | 180.08 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 5-chloro-5-methylcyclohexa-1,3-dien-1-amine;hydrochloride |
| SMILES | CC1(Cl)C=CC=C(N)C1.Cl |
| InChI | InChI=1S/C7H10ClN.ClH/c1-7(8)4-2-3-6(9)5-7;/h2-4H,5,9H2,1H3;1H |
| InChIKey | KPEPXVIRWOIEIN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.08 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-5-methylcyclohexa-1,3-dien-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-5-methylcyclohexa-1,3-dien-1-amine;hydrochloride?
The IUPAC name of 5-chloro-5-methylcyclohexa-1,3-dien-1-amine;hydrochloride (CID 70581444) is 5-chloro-5-methylcyclohexa-1,3-dien-1-amine;hydrochloride.
What is the SMILES notation for 5-chloro-5-methylcyclohexa-1,3-dien-1-amine;hydrochloride?
The canonical SMILES for 5-chloro-5-methylcyclohexa-1,3-dien-1-amine;hydrochloride is CC1(Cl)C=CC=C(N)C1.Cl.
What is the InChIKey of 5-chloro-5-methylcyclohexa-1,3-dien-1-amine;hydrochloride?
The InChIKey is KPEPXVIRWOIEIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN.ClH/c1-7(8)4-2-3-6(9)5-7;/h2-4H,5,9H2,1H3;1H.
What are the key properties of 5-chloro-5-methylcyclohexa-1,3-dien-1-amine;hydrochloride?
5-chloro-5-methylcyclohexa-1,3-dien-1-amine;hydrochloride has a molecular weight of 180.08 g/mol, XLogP of 2.21, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-5-methylcyclohexa-1,3-dien-1-amine;hydrochloride is sourced from PubChem (CID 70581444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).