C17H23ClN2O2 — CID 70581631
2-chloro-N-(2,6-dimethylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)acetamide (PubChem CID 70581631) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is 2-chloro-N-(2,6-dimethylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)acetamide.
| Compound Name | 2-chloro-N-(2,6-dimethylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 70581631 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-chloro-N-(2,6-dimethylphenyl)-N-(2-oxo-2-piperidin-1-ylethyl)acetamide |
| SMILES | Cc1cccc(C)c1N(CC(=O)N1CCCCC1)C(=O)CCl |
| InChI | InChI=1S/C17H23ClN2O2/c1-13-7-6-8-14(2)17(13)20(15(21)11-18)12-16(22)19-9-4-3-5-10-19/h6-8H,3-5,9-12H2,1-2H3 |
| InChIKey | TYESSAIJKVGURY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|