C25H32ClFO5 — CID 70581990
[2-[(8S,9R,10S,13S,14S,17R)-9-chloro-11-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate (PubChem CID 70581990) has the molecular formula C25H32ClFO5 and a molecular weight of 466.98 g/mol. Its IUPAC name is [2-[(8S,9R,10S,13S,14S,17R)-9-chloro-11-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate.
| Compound Name | [2-[(8S,9R,10S,13S,14S,17R)-9-chloro-11-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate |
|---|---|
| PubChem CID | 70581990 |
| Molecular Formula | C25H32ClFO5 |
| Molecular Weight | 466.98 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | [2-[(8S,9R,10S,13S,14S,17R)-9-chloro-11-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propanoate |
| SMILES | CCC(=O)OCC(=O)[C@@]1(O)C(C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)C(F)C[C@@]21C |
| InChI | InChI=1S/C25H32ClFO5/c1-5-21(30)32-13-20(29)25(31)14(2)10-18-17-7-6-15-11-16(28)8-9-22(15,3)24(17,26)19(27)12-23(18,25)4/h8-9,11,14,17-19,31H,5-7,10,12-13H2,1-4H3/t14?,17-,18-,19?,22-,23-,24-,25-/m0/s1 |
| InChIKey | OPRCHMGJOPQFDT-KUCZYMSASA-N |
| XLogP | 4.10 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.98 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|