About 5-methylidene-3,3-diphenylpyrazolidine
5-methylidene-3,3-diphenylpyrazolidine (PubChem CID 70583014) has the molecular formula C16H16N2
and a molecular weight of 236.32 g/mol. Its IUPAC name is 5-methylidene-3,3-diphenylpyrazolidine.
Molecular Properties
| Compound Name | 5-methylidene-3,3-diphenylpyrazolidine |
| PubChem CID | 70583014 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 5-methylidene-3,3-diphenylpyrazolidine |
| SMILES | C=C1CC(c2ccccc2)(c2ccccc2)NN1 |
| InChI | InChI=1S/C16H16N2/c1-13-12-16(18-17-13,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,17-18H,1,12H2 |
| InChIKey | RFHIJLVGWBBNEG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methylidene-3,3-diphenylpyrazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylidene-3,3-diphenylpyrazolidine?
The IUPAC name of 5-methylidene-3,3-diphenylpyrazolidine (CID 70583014) is 5-methylidene-3,3-diphenylpyrazolidine.
What is the SMILES notation for 5-methylidene-3,3-diphenylpyrazolidine?
The canonical SMILES for 5-methylidene-3,3-diphenylpyrazolidine is C=C1CC(c2ccccc2)(c2ccccc2)NN1.
What is the InChIKey of 5-methylidene-3,3-diphenylpyrazolidine?
The InChIKey is RFHIJLVGWBBNEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2/c1-13-12-16(18-17-13,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,17-18H,1,12H2.
What are the key properties of 5-methylidene-3,3-diphenylpyrazolidine?
5-methylidene-3,3-diphenylpyrazolidine has a molecular weight of 236.32 g/mol, XLogP of 2.94, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylidene-3,3-diphenylpyrazolidine is sourced from PubChem (CID 70583014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).