C16H26O6 — CID 70584245
(1S,2S,3S,4R)-3-(carboxymethyl)-4-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentane-1-carboxylic acid (PubChem CID 70584245) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-(carboxymethyl)-4-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentane-1-carboxylic acid.
| Compound Name | (1S,2S,3S,4R)-3-(carboxymethyl)-4-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 70584245 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (1S,2S,3S,4R)-3-(carboxymethyl)-4-hydroxy-2-(8-hydroxyoct-1-enyl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C[C@H]1[C@H](C=CCCCCCCO)[C@@H](C(=O)O)C[C@H]1O |
| InChI | InChI=1S/C16H26O6/c17-8-6-4-2-1-3-5-7-11-12(10-15(19)20)14(18)9-13(11)16(21)22/h5,7,11-14,17-18H,1-4,6,8-10H2,(H,19,20)(H,21,22)/t11-,12-,13-,14+/m0/s1 |
| InChIKey | GVHBSBANPSQHHX-XDQVBPFNSA-N |
| XLogP | 1.66 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|