C7H14N6O4 — CID 70584299
[[4,6-bis(hydroxymethylamino)-1,3,5-triazin-2-yl]amino]methanol;formaldehyde (PubChem CID 70584299) has the molecular formula C7H14N6O4 and a molecular weight of 246.23 g/mol. Its IUPAC name is [[4,6-bis(hydroxymethylamino)-1,3,5-triazin-2-yl]amino]methanol;formaldehyde.
| Compound Name | [[4,6-bis(hydroxymethylamino)-1,3,5-triazin-2-yl]amino]methanol;formaldehyde |
|---|---|
| PubChem CID | 70584299 |
| Molecular Formula | C7H14N6O4 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | [[4,6-bis(hydroxymethylamino)-1,3,5-triazin-2-yl]amino]methanol;formaldehyde |
| SMILES | C=O.OCNc1nc(NCO)nc(NCO)n1 |
| InChI | InChI=1S/C6H12N6O3.CH2O/c13-1-7-4-10-5(8-2-14)12-6(11-4)9-3-15;1-2/h13-15H,1-3H2,(H3,7,8,9,10,11,12);1H2 |
| InChIKey | LRRQIRAXZWZPNB-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 152.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|