C15H13N5NaO4S3 — CID 70584925
CID 70584925 (PubChem CID 70584925) has the molecular formula C15H13N5NaO4S3 and a molecular weight of 446.49 g/mol.
| Compound Name | CID 70584925 |
|---|---|
| PubChem CID | 70584925 |
| Molecular Formula | C15H13N5NaO4S3 |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | — |
| SMILES | Nc1nnc(C2=C(C(=O)O)N3C(=O)C(NC(=O)Cc4cccs4)[C@H]3SC2)s1.[Na] |
| InChI | InChI=1S/C15H13N5O4S3.Na/c16-15-19-18-11(27-15)7-5-26-13-9(12(22)20(13)10(7)14(23)24)17-8(21)4-6-2-1-3-25-6;/h1-3,9,13H,4-5H2,(H2,16,19)(H,17,21)(H,23,24);/t9?,13-;/m1./s1 |
| InChIKey | NMHWOIPRRPQRII-SXMPBOCKSA-N |
| XLogP | 0.24 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |