About 5-[3-[4-(2,4-dichlorophenoxy)phenyl]-2-methylpropyl]-2-methyl-1H-imidazole
5-[3-[4-(2,4-dichlorophenoxy)phenyl]-2-methylpropyl]-2-methyl-1H-imidazole (PubChem CID 70584961) has the molecular formula C20H20Cl2N2O
and a molecular weight of 375.30 g/mol. Its IUPAC name is 5-[3-[4-(2,4-dichlorophenoxy)phenyl]-2-methylpropyl]-2-methyl-1H-imidazole.
Molecular Properties
| Compound Name | 5-[3-[4-(2,4-dichlorophenoxy)phenyl]-2-methylpropyl]-2-methyl-1H-imidazole |
| PubChem CID | 70584961 |
| Molecular Formula | C20H20Cl2N2O |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 5-[3-[4-(2,4-dichlorophenoxy)phenyl]-2-methylpropyl]-2-methyl-1H-imidazole |
| SMILES | Cc1ncc(CC(C)Cc2ccc(Oc3ccc(Cl)cc3Cl)cc2)[nH]1 |
| InChI | InChI=1S/C20H20Cl2N2O/c1-13(10-17-12-23-14(2)24-17)9-15-3-6-18(7-4-15)25-20-8-5-16(21)11-19(20)22/h3-8,11-13H,9-10H2,1-2H3,(H,23,24) |
| InChIKey | JPMZXMBQKDNGMS-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[3-[4-(2,4-dichlorophenoxy)phenyl]-2-methylpropyl]-2-methyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[4-(2,4-dichlorophenoxy)phenyl]-2-methylpropyl]-2-methyl-1H-imidazole?
The IUPAC name of 5-[3-[4-(2,4-dichlorophenoxy)phenyl]-2-methylpropyl]-2-methyl-1H-imidazole (CID 70584961) is 5-[3-[4-(2,4-dichlorophenoxy)phenyl]-2-methylpropyl]-2-methyl-1H-imidazole.
What is the SMILES notation for 5-[3-[4-(2,4-dichlorophenoxy)phenyl]-2-methylpropyl]-2-methyl-1H-imidazole?
The canonical SMILES for 5-[3-[4-(2,4-dichlorophenoxy)phenyl]-2-methylpropyl]-2-methyl-1H-imidazole is Cc1ncc(CC(C)Cc2ccc(Oc3ccc(Cl)cc3Cl)cc2)[nH]1.
What is the InChIKey of 5-[3-[4-(2,4-dichlorophenoxy)phenyl]-2-methylpropyl]-2-methyl-1H-imidazole?
The InChIKey is JPMZXMBQKDNGMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20Cl2N2O/c1-13(10-17-12-23-14(2)24-17)9-15-3-6-18(7-4-15)25-20-8-5-16(21)11-19(20)22/h3-8,11-13H,9-10H2,1-2H3,(H,23,24).
What are the key properties of 5-[3-[4-(2,4-dichlorophenoxy)phenyl]-2-methylpropyl]-2-methyl-1H-imidazole?
5-[3-[4-(2,4-dichlorophenoxy)phenyl]-2-methylpropyl]-2-methyl-1H-imidazole has a molecular weight of 375.30 g/mol, XLogP of 6.24, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[4-(2,4-dichlorophenoxy)phenyl]-2-methylpropyl]-2-methyl-1H-imidazole is sourced from PubChem (CID 70584961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).