C18H31N — CID 70585406
2-(3,3-dimethylpentyl)-1-azacyclododeca-4,8,12-triene (PubChem CID 70585406) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 2-(3,3-dimethylpentyl)-1-azacyclododeca-4,8,12-triene.
| Compound Name | 2-(3,3-dimethylpentyl)-1-azacyclododeca-4,8,12-triene |
|---|---|
| PubChem CID | 70585406 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 2-(3,3-dimethylpentyl)-1-azacyclododeca-4,8,12-triene |
| SMILES | CCC(C)(C)CCC1CC=CCCC=CCC/C=N/1 |
| InChI | InChI=1S/C18H31N/c1-4-18(2,3)15-14-17-13-11-9-7-5-6-8-10-12-16-19-17/h6,8-9,11,16-17H,4-5,7,10,12-15H2,1-3H3/b8-6?,11-9?,19-16+ |
| InChIKey | LZBAEYCKTOLCBR-VPKGWAGBSA-N |
| XLogP | 5.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|