C16H25N — CID 70585416
2-pent-3-en-2-yl-1-azacyclododeca-1,5,9-triene (PubChem CID 70585416) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 2-pent-3-en-2-yl-1-azacyclododeca-1,5,9-triene.
| Compound Name | 2-pent-3-en-2-yl-1-azacyclododeca-1,5,9-triene |
|---|---|
| PubChem CID | 70585416 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 2-pent-3-en-2-yl-1-azacyclododeca-1,5,9-triene |
| SMILES | CC=CC(C)/C1=N\CCC=CCCC=CCC1 |
| InChI | InChI=1S/C16H25N/c1-3-12-15(2)16-13-10-8-6-4-5-7-9-11-14-17-16/h3,6-9,12,15H,4-5,10-11,13-14H2,1-2H3/b8-6?,9-7?,12-3?,17-16- |
| InChIKey | XJWIWEAWGNBYLR-ODQQPJOOSA-N |
| XLogP | 4.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|