C22H28O5S — CID 70585651
[(1R)-4-(benzenesulfonylmethyl)-2-methyl-5-oxo-1,2,3,6,7,7a-hexahydroinden-1-yl] 2,2-dimethylpropanoate (PubChem CID 70585651) has the molecular formula C22H28O5S and a molecular weight of 404.53 g/mol. Its IUPAC name is [(1R)-4-(benzenesulfonylmethyl)-2-methyl-5-oxo-1,2,3,6,7,7a-hexahydroinden-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1R)-4-(benzenesulfonylmethyl)-2-methyl-5-oxo-1,2,3,6,7,7a-hexahydroinden-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 70585651 |
| Molecular Formula | C22H28O5S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [(1R)-4-(benzenesulfonylmethyl)-2-methyl-5-oxo-1,2,3,6,7,7a-hexahydroinden-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC1CC2=C(CS(=O)(=O)c3ccccc3)C(=O)CCC2[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C22H28O5S/c1-14-12-17-16(20(14)27-21(24)22(2,3)4)10-11-19(23)18(17)13-28(25,26)15-8-6-5-7-9-15/h5-9,14,16,20H,10-13H2,1-4H3/t14?,16?,20-/m1/s1 |
| InChIKey | LFUHDRLKMWSOGA-QJXPYNDKSA-N |
| XLogP | 3.73 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |