About bis(1-decan-4-yloxycyclohexa-2,4-dien-1-yl)methanone
bis(1-decan-4-yloxycyclohexa-2,4-dien-1-yl)methanone (PubChem CID 70585667) has the molecular formula C33H54O3
and a molecular weight of 498.79 g/mol. Its IUPAC name is bis(1-decan-4-yloxycyclohexa-2,4-dien-1-yl)methanone.
Molecular Properties
| Compound Name | bis(1-decan-4-yloxycyclohexa-2,4-dien-1-yl)methanone |
| PubChem CID | 70585667 |
| Molecular Formula | C33H54O3 |
| Molecular Weight | 498.79 g/mol |
| Exact Mass | 498.41 |
| IUPAC Name | bis(1-decan-4-yloxycyclohexa-2,4-dien-1-yl)methanone |
| SMILES | CCCCCCC(CCC)OC1(C(=O)C2(OC(CCC)CCCCCC)C=CC=CC2)C=CC=CC1 |
| InChI | InChI=1S/C33H54O3/c1-5-9-11-15-23-29(21-7-3)35-32(25-17-13-18-26-32)31(34)33(27-19-14-20-28-33)36-30(22-8-4)24-16-12-10-6-2/h13-14,17-20,25,27,29-30H,5-12,15-16,21-24,26,28H2,1-4H3 |
| InChIKey | FHAOMRLCGSEQRQ-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.79 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(1-decan-4-yloxycyclohexa-2,4-dien-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-decan-4-yloxycyclohexa-2,4-dien-1-yl)methanone?
The IUPAC name of bis(1-decan-4-yloxycyclohexa-2,4-dien-1-yl)methanone (CID 70585667) is bis(1-decan-4-yloxycyclohexa-2,4-dien-1-yl)methanone.
What is the SMILES notation for bis(1-decan-4-yloxycyclohexa-2,4-dien-1-yl)methanone?
The canonical SMILES for bis(1-decan-4-yloxycyclohexa-2,4-dien-1-yl)methanone is CCCCCCC(CCC)OC1(C(=O)C2(OC(CCC)CCCCCC)C=CC=CC2)C=CC=CC1.
What is the InChIKey of bis(1-decan-4-yloxycyclohexa-2,4-dien-1-yl)methanone?
The InChIKey is FHAOMRLCGSEQRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H54O3/c1-5-9-11-15-23-29(21-7-3)35-32(25-17-13-18-26-32)31(34)33(27-19-14-20-28-33)36-30(22-8-4)24-16-12-10-6-2/h13-14,17-20,25,27,29-30H,5-12,15-16,21-24,26,28H2,1-4H3.
What are the key properties of bis(1-decan-4-yloxycyclohexa-2,4-dien-1-yl)methanone?
bis(1-decan-4-yloxycyclohexa-2,4-dien-1-yl)methanone has a molecular weight of 498.79 g/mol, XLogP of 9.38, 20 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-decan-4-yloxycyclohexa-2,4-dien-1-yl)methanone is sourced from PubChem (CID 70585667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).