About 4-fluorotriazolo[4,5-i][1,2]benzodiazepine
4-fluorotriazolo[4,5-i][1,2]benzodiazepine (PubChem CID 70585918) has the molecular formula C9H4FN5
and a molecular weight of 201.16 g/mol. Its IUPAC name is 4-fluorotriazolo[4,5-i][1,2]benzodiazepine.
Molecular Properties
| Compound Name | 4-fluorotriazolo[4,5-i][1,2]benzodiazepine |
| PubChem CID | 70585918 |
| Molecular Formula | C9H4FN5 |
| Molecular Weight | 201.16 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 4-fluorotriazolo[4,5-i][1,2]benzodiazepine |
| SMILES | Fc1cc2cccnnc2c2nnnc12 |
| InChI | InChI=1S/C9H4FN5/c10-6-4-5-2-1-3-11-12-7(5)9-8(6)13-15-14-9/h1-4H |
| InChIKey | WKCWLUOGCCLWKQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.16 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-fluorotriazolo[4,5-i][1,2]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorotriazolo[4,5-i][1,2]benzodiazepine?
The IUPAC name of 4-fluorotriazolo[4,5-i][1,2]benzodiazepine (CID 70585918) is 4-fluorotriazolo[4,5-i][1,2]benzodiazepine.
What is the SMILES notation for 4-fluorotriazolo[4,5-i][1,2]benzodiazepine?
The canonical SMILES for 4-fluorotriazolo[4,5-i][1,2]benzodiazepine is Fc1cc2cccnnc2c2nnnc12.
What is the InChIKey of 4-fluorotriazolo[4,5-i][1,2]benzodiazepine?
The InChIKey is WKCWLUOGCCLWKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4FN5/c10-6-4-5-2-1-3-11-12-7(5)9-8(6)13-15-14-9/h1-4H.
What are the key properties of 4-fluorotriazolo[4,5-i][1,2]benzodiazepine?
4-fluorotriazolo[4,5-i][1,2]benzodiazepine has a molecular weight of 201.16 g/mol, XLogP of 1.11, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorotriazolo[4,5-i][1,2]benzodiazepine is sourced from PubChem (CID 70585918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).