C9H13N3O3S — CID 70586112
1-(3-prop-2-enylsulfanylpropyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 70586112) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 1-(3-prop-2-enylsulfanylpropyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(3-prop-2-enylsulfanylpropyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 70586112 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 1-(3-prop-2-enylsulfanylpropyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCSCCCn1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H13N3O3S/c1-2-5-16-6-3-4-12-8(14)10-7(13)11-9(12)15/h2H,1,3-6H2,(H2,10,11,13,14,15) |
| InChIKey | YXAJVGQLVCVBNP-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|