C9H17N3O — CID 70586252
6-methoxy-1-N',1-N'-dimethylcyclohexa-2,4-diene-1,1,3-triamine (PubChem CID 70586252) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 6-methoxy-1-N',1-N'-dimethylcyclohexa-2,4-diene-1,1,3-triamine.
| Compound Name | 6-methoxy-1-N',1-N'-dimethylcyclohexa-2,4-diene-1,1,3-triamine |
|---|---|
| PubChem CID | 70586252 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 6-methoxy-1-N',1-N'-dimethylcyclohexa-2,4-diene-1,1,3-triamine |
| SMILES | COC1C=CC(N)=CC1(N)N(C)C |
| InChI | InChI=1S/C9H17N3O/c1-12(2)9(11)6-7(10)4-5-8(9)13-3/h4-6,8H,10-11H2,1-3H3 |
| InChIKey | YFPRDLPNILVBJD-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|