C14H19BrF4O4 — CID 70586281
2-bromo-5,5,6,6-tetrakis(1-fluoroethoxy)cyclohexa-1,3-diene (PubChem CID 70586281) has the molecular formula C14H19BrF4O4 and a molecular weight of 407.20 g/mol. Its IUPAC name is 2-bromo-5,5,6,6-tetrakis(1-fluoroethoxy)cyclohexa-1,3-diene.
| Compound Name | 2-bromo-5,5,6,6-tetrakis(1-fluoroethoxy)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 70586281 |
| Molecular Formula | C14H19BrF4O4 |
| Molecular Weight | 407.20 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 2-bromo-5,5,6,6-tetrakis(1-fluoroethoxy)cyclohexa-1,3-diene |
| SMILES | CC(F)OC1(OC(C)F)C=CC(Br)=CC1(OC(C)F)OC(C)F |
| InChI | InChI=1S/C14H19BrF4O4/c1-8(16)20-13(21-9(2)17)6-5-12(15)7-14(13,22-10(3)18)23-11(4)19/h5-11H,1-4H3 |
| InChIKey | GUPVGUGEZWDYLD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.20 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|