C8H15N3O — CID 70586400
6-methoxy-1-N'-methylcyclohexa-2,4-diene-1,1,3-triamine (PubChem CID 70586400) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 6-methoxy-1-N'-methylcyclohexa-2,4-diene-1,1,3-triamine.
| Compound Name | 6-methoxy-1-N'-methylcyclohexa-2,4-diene-1,1,3-triamine |
|---|---|
| PubChem CID | 70586400 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 6-methoxy-1-N'-methylcyclohexa-2,4-diene-1,1,3-triamine |
| SMILES | CNC1(N)C=C(N)C=CC1OC |
| InChI | InChI=1S/C8H15N3O/c1-11-8(10)5-6(9)3-4-7(8)12-2/h3-5,7,11H,9-10H2,1-2H3 |
| InChIKey | PPMZEEGYGYBSTK-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|