About (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine
(3R,4S)-4-chloro-1,1-dioxothiolan-3-amine (PubChem CID 7058647) has the molecular formula C4H8ClNO2S
and a molecular weight of 169.63 g/mol. Its IUPAC name is (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine |
| PubChem CID | 7058647 |
| Molecular Formula | C4H8ClNO2S |
| Molecular Weight | 169.63 g/mol |
| Exact Mass | 169.00 |
| IUPAC Name | (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine |
| SMILES | N[C@@H]1CS(=O)(=O)C[C@H]1Cl |
| InChI | InChI=1S/C4H8ClNO2S/c5-3-1-9(7,8)2-4(3)6/h3-4H,1-2,6H2/t3-,4-/m1/s1 |
| InChIKey | COPRYPAOGCTLCJ-QWWZWVQMSA-N |
| XLogP | -0.65 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.63 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine?
The IUPAC name of (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine (CID 7058647) is (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine.
What is the SMILES notation for (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine?
The canonical SMILES for (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine is N[C@@H]1CS(=O)(=O)C[C@H]1Cl.
What is the InChIKey of (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine?
The InChIKey is COPRYPAOGCTLCJ-QWWZWVQMSA-N. The full InChI is InChI=1S/C4H8ClNO2S/c5-3-1-9(7,8)2-4(3)6/h3-4H,1-2,6H2/t3-,4-/m1/s1.
What are the key properties of (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine?
(3R,4S)-4-chloro-1,1-dioxothiolan-3-amine has a molecular weight of 169.63 g/mol, XLogP of -0.65, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-chloro-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 7058647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).