C24H36O4 — CID 70586511
[(8S,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-11-yl] prop-2-enoate (PubChem CID 70586511) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is [(8S,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-11-yl] prop-2-enoate.
| Compound Name | [(8S,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-11-yl] prop-2-enoate |
|---|---|
| PubChem CID | 70586511 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | [(8S,9S,10S,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-11-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC1C[C@]2(C)[C@@H](C(C)=O)CC[C@H]2[C@@H]2CCC3CC(O)CC[C@]3(C)[C@@H]12 |
| InChI | InChI=1S/C24H36O4/c1-5-21(27)28-20-13-24(4)18(14(2)25)8-9-19(24)17-7-6-15-12-16(26)10-11-23(15,3)22(17)20/h5,15-20,22,26H,1,6-13H2,2-4H3/t15?,16?,17-,18+,19-,20?,22+,23-,24+/m0/s1 |
| InChIKey | DRGKZDWWTUTJSM-GSANHMLKSA-N |
| XLogP | 4.30 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|