C24H39NO2 — CID 70586701
(2E,6Z,10E)-7-(hydroxymethyl)-3,11,15-trimethyl-1-pyrrolidin-1-ylhexadeca-2,6,10,14-tetraen-1-one (PubChem CID 70586701) has the molecular formula C24H39NO2 and a molecular weight of 373.58 g/mol. Its IUPAC name is (2E,6Z,10E)-7-(hydroxymethyl)-3,11,15-trimethyl-1-pyrrolidin-1-ylhexadeca-2,6,10,14-tetraen-1-one.
| Compound Name | (2E,6Z,10E)-7-(hydroxymethyl)-3,11,15-trimethyl-1-pyrrolidin-1-ylhexadeca-2,6,10,14-tetraen-1-one |
|---|---|
| PubChem CID | 70586701 |
| Molecular Formula | C24H39NO2 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | (2E,6Z,10E)-7-(hydroxymethyl)-3,11,15-trimethyl-1-pyrrolidin-1-ylhexadeca-2,6,10,14-tetraen-1-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(=C/CC/C(C)=C/C(=O)N1CCCC1)CO |
| InChI | InChI=1S/C24H39NO2/c1-20(2)10-7-11-21(3)12-8-14-23(19-26)15-9-13-22(4)18-24(27)25-16-5-6-17-25/h10,12,15,18,26H,5-9,11,13-14,16-17,19H2,1-4H3/b21-12+,22-18+,23-15- |
| InChIKey | GOPIKNKIVCDPFU-LIPBWJQISA-N |
| XLogP | 5.73 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|