About 2-[2-(4-fluorophenyl)-3,3-dimethylbut-1-enyl]-1H-imidazole;hydrochloride
2-[2-(4-fluorophenyl)-3,3-dimethylbut-1-enyl]-1H-imidazole;hydrochloride (PubChem CID 70587272) has the molecular formula C15H18ClFN2
and a molecular weight of 280.77 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-3,3-dimethylbut-1-enyl]-1H-imidazole;hydrochloride.
Molecular Properties
| Compound Name | 2-[2-(4-fluorophenyl)-3,3-dimethylbut-1-enyl]-1H-imidazole;hydrochloride |
| PubChem CID | 70587272 |
| Molecular Formula | C15H18ClFN2 |
| Molecular Weight | 280.77 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-3,3-dimethylbut-1-enyl]-1H-imidazole;hydrochloride |
| SMILES | CC(C)(C)C(=Cc1ncc[nH]1)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C15H17FN2.ClH/c1-15(2,3)13(10-14-17-8-9-18-14)11-4-6-12(16)7-5-11;/h4-10H,1-3H3,(H,17,18);1H |
| InChIKey | CWXVVPSNHSQMEH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.77 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[2-(4-fluorophenyl)-3,3-dimethylbut-1-enyl]-1H-imidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-fluorophenyl)-3,3-dimethylbut-1-enyl]-1H-imidazole;hydrochloride?
The IUPAC name of 2-[2-(4-fluorophenyl)-3,3-dimethylbut-1-enyl]-1H-imidazole;hydrochloride (CID 70587272) is 2-[2-(4-fluorophenyl)-3,3-dimethylbut-1-enyl]-1H-imidazole;hydrochloride.
What is the SMILES notation for 2-[2-(4-fluorophenyl)-3,3-dimethylbut-1-enyl]-1H-imidazole;hydrochloride?
The canonical SMILES for 2-[2-(4-fluorophenyl)-3,3-dimethylbut-1-enyl]-1H-imidazole;hydrochloride is CC(C)(C)C(=Cc1ncc[nH]1)c1ccc(F)cc1.Cl.
What is the InChIKey of 2-[2-(4-fluorophenyl)-3,3-dimethylbut-1-enyl]-1H-imidazole;hydrochloride?
The InChIKey is CWXVVPSNHSQMEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FN2.ClH/c1-15(2,3)13(10-14-17-8-9-18-14)11-4-6-12(16)7-5-11;/h4-10H,1-3H3,(H,17,18);1H.
What are the key properties of 2-[2-(4-fluorophenyl)-3,3-dimethylbut-1-enyl]-1H-imidazole;hydrochloride?
2-[2-(4-fluorophenyl)-3,3-dimethylbut-1-enyl]-1H-imidazole;hydrochloride has a molecular weight of 280.77 g/mol, XLogP of 4.56, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-fluorophenyl)-3,3-dimethylbut-1-enyl]-1H-imidazole;hydrochloride is sourced from PubChem (CID 70587272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).