C9H15N — CID 70587294
1-methylidene-3,5,6,7,8,8a-hexahydro-2H-indolizine (PubChem CID 70587294) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 1-methylidene-3,5,6,7,8,8a-hexahydro-2H-indolizine.
| Compound Name | 1-methylidene-3,5,6,7,8,8a-hexahydro-2H-indolizine |
|---|---|
| PubChem CID | 70587294 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 1-methylidene-3,5,6,7,8,8a-hexahydro-2H-indolizine |
| SMILES | C=C1CCN2CCCCC12 |
| InChI | InChI=1S/C9H15N/c1-8-5-7-10-6-3-2-4-9(8)10/h9H,1-7H2 |
| InChIKey | PRSHQWRGVVSDOI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|