About [3-(2-butoxyethoxycarbonyloxy)-4-(3-ethylphenyl)-6-methyl-1,4-dihydropyridazin-5-yl] 2-butoxyethyl carbonate
[3-(2-butoxyethoxycarbonyloxy)-4-(3-ethylphenyl)-6-methyl-1,4-dihydropyridazin-5-yl] 2-butoxyethyl carbonate (PubChem CID 70587336) has the molecular formula C27H40N2O8
and a molecular weight of 520.62 g/mol. Its IUPAC name is [3-(2-butoxyethoxycarbonyloxy)-4-(3-ethylphenyl)-6-methyl-1,4-dihydropyridazin-5-yl] 2-butoxyethyl carbonate.
Molecular Properties
| Compound Name | [3-(2-butoxyethoxycarbonyloxy)-4-(3-ethylphenyl)-6-methyl-1,4-dihydropyridazin-5-yl] 2-butoxyethyl carbonate |
| PubChem CID | 70587336 |
| Molecular Formula | C27H40N2O8 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | [3-(2-butoxyethoxycarbonyloxy)-4-(3-ethylphenyl)-6-methyl-1,4-dihydropyridazin-5-yl] 2-butoxyethyl carbonate |
| SMILES | CCCCOCCOC(=O)OC1=NNC(C)=C(OC(=O)OCCOCCCC)C1c1cccc(CC)c1 |
| InChI | InChI=1S/C27H40N2O8/c1-5-8-13-32-15-17-34-26(30)36-24-20(4)28-29-25(23(24)22-12-10-11-21(7-3)19-22)37-27(31)35-18-16-33-14-9-6-2/h10-12,19,23,28H,5-9,13-18H2,1-4H3 |
| InChIKey | GXYLUNAZSBRXAT-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-(2-butoxyethoxycarbonyloxy)-4-(3-ethylphenyl)-6-methyl-1,4-dihydropyridazin-5-yl] 2-butoxyethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-butoxyethoxycarbonyloxy)-4-(3-ethylphenyl)-6-methyl-1,4-dihydropyridazin-5-yl] 2-butoxyethyl carbonate?
The IUPAC name of [3-(2-butoxyethoxycarbonyloxy)-4-(3-ethylphenyl)-6-methyl-1,4-dihydropyridazin-5-yl] 2-butoxyethyl carbonate (CID 70587336) is [3-(2-butoxyethoxycarbonyloxy)-4-(3-ethylphenyl)-6-methyl-1,4-dihydropyridazin-5-yl] 2-butoxyethyl carbonate.
What is the SMILES notation for [3-(2-butoxyethoxycarbonyloxy)-4-(3-ethylphenyl)-6-methyl-1,4-dihydropyridazin-5-yl] 2-butoxyethyl carbonate?
The canonical SMILES for [3-(2-butoxyethoxycarbonyloxy)-4-(3-ethylphenyl)-6-methyl-1,4-dihydropyridazin-5-yl] 2-butoxyethyl carbonate is CCCCOCCOC(=O)OC1=NNC(C)=C(OC(=O)OCCOCCCC)C1c1cccc(CC)c1.
What is the InChIKey of [3-(2-butoxyethoxycarbonyloxy)-4-(3-ethylphenyl)-6-methyl-1,4-dihydropyridazin-5-yl] 2-butoxyethyl carbonate?
The InChIKey is GXYLUNAZSBRXAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H40N2O8/c1-5-8-13-32-15-17-34-26(30)36-24-20(4)28-29-25(23(24)22-12-10-11-21(7-3)19-22)37-27(31)35-18-16-33-14-9-6-2/h10-12,19,23,28H,5-9,13-18H2,1-4H3.
What are the key properties of [3-(2-butoxyethoxycarbonyloxy)-4-(3-ethylphenyl)-6-methyl-1,4-dihydropyridazin-5-yl] 2-butoxyethyl carbonate?
[3-(2-butoxyethoxycarbonyloxy)-4-(3-ethylphenyl)-6-methyl-1,4-dihydropyridazin-5-yl] 2-butoxyethyl carbonate has a molecular weight of 520.62 g/mol, XLogP of 5.42, 15 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-butoxyethoxycarbonyloxy)-4-(3-ethylphenyl)-6-methyl-1,4-dihydropyridazin-5-yl] 2-butoxyethyl carbonate is sourced from PubChem (CID 70587336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).