C17H23N — CID 70587683
(9aS,9bR,11aR)-11a-methyl-5,5a,6,7,8,9,9a,9b,10,11-decahydrocyclopenta[c]phenanthridine (PubChem CID 70587683) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is (9aS,9bR,11aR)-11a-methyl-5,5a,6,7,8,9,9a,9b,10,11-decahydrocyclopenta[c]phenanthridine.
| Compound Name | (9aS,9bR,11aR)-11a-methyl-5,5a,6,7,8,9,9a,9b,10,11-decahydrocyclopenta[c]phenanthridine |
|---|---|
| PubChem CID | 70587683 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (9aS,9bR,11aR)-11a-methyl-5,5a,6,7,8,9,9a,9b,10,11-decahydrocyclopenta[c]phenanthridine |
| SMILES | C[C@@]12C=CC=C1C1=NCC3CCCC[C@@H]3[C@H]1CC2 |
| InChI | InChI=1S/C17H23N/c1-17-9-4-7-15(17)16-14(8-10-17)13-6-3-2-5-12(13)11-18-16/h4,7,9,12-14H,2-3,5-6,8,10-11H2,1H3/t12?,13-,14+,17-/m0/s1 |
| InChIKey | YFRCASLDODTMQW-PLTIAYLTSA-N |
| XLogP | 4.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |