C27H32N4O2 — CID 70587823
methyl 5-amino-2-[[3-phenyl-2-(4-phenylpiperazin-1-yl)propyl]amino]benzoate (PubChem CID 70587823) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is methyl 5-amino-2-[[3-phenyl-2-(4-phenylpiperazin-1-yl)propyl]amino]benzoate.
| Compound Name | methyl 5-amino-2-[[3-phenyl-2-(4-phenylpiperazin-1-yl)propyl]amino]benzoate |
|---|---|
| PubChem CID | 70587823 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | methyl 5-amino-2-[[3-phenyl-2-(4-phenylpiperazin-1-yl)propyl]amino]benzoate |
| SMILES | COC(=O)c1cc(N)ccc1NCC(Cc1ccccc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H32N4O2/c1-33-27(32)25-19-22(28)12-13-26(25)29-20-24(18-21-8-4-2-5-9-21)31-16-14-30(15-17-31)23-10-6-3-7-11-23/h2-13,19,24,29H,14-18,20,28H2,1H3 |
| InChIKey | DMEODGSTKXBZDC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|